About 5-(2,6-diethylphenyl)-1-[4-(difluoromethoxy)phenyl]pyrrolo[2,3-c]pyridine
5-(2,6-diethylphenyl)-1-[4-(difluoromethoxy)phenyl]pyrrolo[2,3-c]pyridine (PubChem CID 67152444) has the molecular formula C24H22F2N2O
and a molecular weight of 392.45 g/mol. Its IUPAC name is 5-(2,6-diethylphenyl)-1-[4-(difluoromethoxy)phenyl]pyrrolo[2,3-c]pyridine.
Molecular Properties
| Compound Name | 5-(2,6-diethylphenyl)-1-[4-(difluoromethoxy)phenyl]pyrrolo[2,3-c]pyridine |
| PubChem CID | 67152444 |
| Molecular Formula | C24H22F2N2O |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 5-(2,6-diethylphenyl)-1-[4-(difluoromethoxy)phenyl]pyrrolo[2,3-c]pyridine |
| SMILES | CCc1cccc(CC)c1-c1cc2ccn(-c3ccc(OC(F)F)cc3)c2cn1 |
| InChI | InChI=1S/C24H22F2N2O/c1-3-16-6-5-7-17(4-2)23(16)21-14-18-12-13-28(22(18)15-27-21)19-8-10-20(11-9-19)29-24(25)26/h5-15,24H,3-4H2,1-2H3 |
| InChIKey | JSDGZPSBOBHCQG-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(2,6-diethylphenyl)-1-[4-(difluoromethoxy)phenyl]pyrrolo[2,3-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,6-diethylphenyl)-1-[4-(difluoromethoxy)phenyl]pyrrolo[2,3-c]pyridine?
The IUPAC name of 5-(2,6-diethylphenyl)-1-[4-(difluoromethoxy)phenyl]pyrrolo[2,3-c]pyridine (CID 67152444) is 5-(2,6-diethylphenyl)-1-[4-(difluoromethoxy)phenyl]pyrrolo[2,3-c]pyridine.
What is the SMILES notation for 5-(2,6-diethylphenyl)-1-[4-(difluoromethoxy)phenyl]pyrrolo[2,3-c]pyridine?
The canonical SMILES for 5-(2,6-diethylphenyl)-1-[4-(difluoromethoxy)phenyl]pyrrolo[2,3-c]pyridine is CCc1cccc(CC)c1-c1cc2ccn(-c3ccc(OC(F)F)cc3)c2cn1.
What is the InChIKey of 5-(2,6-diethylphenyl)-1-[4-(difluoromethoxy)phenyl]pyrrolo[2,3-c]pyridine?
The InChIKey is JSDGZPSBOBHCQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22F2N2O/c1-3-16-6-5-7-17(4-2)23(16)21-14-18-12-13-28(22(18)15-27-21)19-8-10-20(11-9-19)29-24(25)26/h5-15,24H,3-4H2,1-2H3.
What are the key properties of 5-(2,6-diethylphenyl)-1-[4-(difluoromethoxy)phenyl]pyrrolo[2,3-c]pyridine?
5-(2,6-diethylphenyl)-1-[4-(difluoromethoxy)phenyl]pyrrolo[2,3-c]pyridine has a molecular weight of 392.45 g/mol, XLogP of 6.42, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,6-diethylphenyl)-1-[4-(difluoromethoxy)phenyl]pyrrolo[2,3-c]pyridine is sourced from PubChem (CID 67152444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).