C30H24F3N5O4 — CID 67152833
benzyl N-[amino-[[4-[1-(2-cyanobenzoyl)-3,6-dihydro-2H-pyridin-4-yl]-3-(trifluoromethyl)benzoyl]amino]methylidene]carbamate (PubChem CID 67152833) has the molecular formula C30H24F3N5O4 and a molecular weight of 575.55 g/mol. Its IUPAC name is benzyl N-[amino-[[4-[1-(2-cyanobenzoyl)-3,6-dihydro-2H-pyridin-4-yl]-3-(trifluoromethyl)benzoyl]amino]methylidene]carbamate.
| Compound Name | benzyl N-[amino-[[4-[1-(2-cyanobenzoyl)-3,6-dihydro-2H-pyridin-4-yl]-3-(trifluoromethyl)benzoyl]amino]methylidene]carbamate |
|---|---|
| PubChem CID | 67152833 |
| Molecular Formula | C30H24F3N5O4 |
| Molecular Weight | 575.55 g/mol |
| Exact Mass | 575.18 |
| IUPAC Name | benzyl N-[amino-[[4-[1-(2-cyanobenzoyl)-3,6-dihydro-2H-pyridin-4-yl]-3-(trifluoromethyl)benzoyl]amino]methylidene]carbamate |
| SMILES | N#Cc1ccccc1C(=O)N1CC=C(c2ccc(C(=O)NC(N)=NC(=O)OCc3ccccc3)cc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C30H24F3N5O4/c31-30(32,33)25-16-21(26(39)36-28(35)37-29(41)42-18-19-6-2-1-3-7-19)10-11-23(25)20-12-14-38(15-13-20)27(40)24-9-5-4-8-22(24)17-34/h1-12,16H,13-15,18H2,(H3,35,36,37,39,41) |
| InChIKey | ZIKZVQKQSRPAPO-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 137.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.55 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|