About methyl 4-[1-[4-bromo-3-(1,3-dioxan-2-yl)phenoxy]-3-methylbutyl]benzoate
methyl 4-[1-[4-bromo-3-(1,3-dioxan-2-yl)phenoxy]-3-methylbutyl]benzoate (PubChem CID 67153378) has the molecular formula C23H27BrO5
and a molecular weight of 463.37 g/mol. Its IUPAC name is methyl 4-[1-[4-bromo-3-(1,3-dioxan-2-yl)phenoxy]-3-methylbutyl]benzoate.
Molecular Properties
| Compound Name | methyl 4-[1-[4-bromo-3-(1,3-dioxan-2-yl)phenoxy]-3-methylbutyl]benzoate |
| PubChem CID | 67153378 |
| Molecular Formula | C23H27BrO5 |
| Molecular Weight | 463.37 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | methyl 4-[1-[4-bromo-3-(1,3-dioxan-2-yl)phenoxy]-3-methylbutyl]benzoate |
| SMILES | COC(=O)c1ccc(C(CC(C)C)Oc2ccc(Br)c(C3OCCCO3)c2)cc1 |
| InChI | InChI=1S/C23H27BrO5/c1-15(2)13-21(16-5-7-17(8-6-16)22(25)26-3)29-18-9-10-20(24)19(14-18)23-27-11-4-12-28-23/h5-10,14-15,21,23H,4,11-13H2,1-3H3 |
| InChIKey | ZWBYLHWTVPQMAE-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 463.37 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 4-[1-[4-bromo-3-(1,3-dioxan-2-yl)phenoxy]-3-methylbutyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[1-[4-bromo-3-(1,3-dioxan-2-yl)phenoxy]-3-methylbutyl]benzoate?
The IUPAC name of methyl 4-[1-[4-bromo-3-(1,3-dioxan-2-yl)phenoxy]-3-methylbutyl]benzoate (CID 67153378) is methyl 4-[1-[4-bromo-3-(1,3-dioxan-2-yl)phenoxy]-3-methylbutyl]benzoate.
What is the SMILES notation for methyl 4-[1-[4-bromo-3-(1,3-dioxan-2-yl)phenoxy]-3-methylbutyl]benzoate?
The canonical SMILES for methyl 4-[1-[4-bromo-3-(1,3-dioxan-2-yl)phenoxy]-3-methylbutyl]benzoate is COC(=O)c1ccc(C(CC(C)C)Oc2ccc(Br)c(C3OCCCO3)c2)cc1.
What is the InChIKey of methyl 4-[1-[4-bromo-3-(1,3-dioxan-2-yl)phenoxy]-3-methylbutyl]benzoate?
The InChIKey is ZWBYLHWTVPQMAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H27BrO5/c1-15(2)13-21(16-5-7-17(8-6-16)22(25)26-3)29-18-9-10-20(24)19(14-18)23-27-11-4-12-28-23/h5-10,14-15,21,23H,4,11-13H2,1-3H3.
What are the key properties of methyl 4-[1-[4-bromo-3-(1,3-dioxan-2-yl)phenoxy]-3-methylbutyl]benzoate?
methyl 4-[1-[4-bromo-3-(1,3-dioxan-2-yl)phenoxy]-3-methylbutyl]benzoate has a molecular weight of 463.37 g/mol, XLogP of 5.84, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[1-[4-bromo-3-(1,3-dioxan-2-yl)phenoxy]-3-methylbutyl]benzoate is sourced from PubChem (CID 67153378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).