About 2,6-dioxo-4,4-diphenylcyclohexane-1-carboxamide
2,6-dioxo-4,4-diphenylcyclohexane-1-carboxamide (PubChem CID 67153697) has the molecular formula C19H17NO3
and a molecular weight of 307.35 g/mol. Its IUPAC name is 2,6-dioxo-4,4-diphenylcyclohexane-1-carboxamide.
Molecular Properties
| Compound Name | 2,6-dioxo-4,4-diphenylcyclohexane-1-carboxamide |
| PubChem CID | 67153697 |
| Molecular Formula | C19H17NO3 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 2,6-dioxo-4,4-diphenylcyclohexane-1-carboxamide |
| SMILES | NC(=O)C1C(=O)CC(c2ccccc2)(c2ccccc2)CC1=O |
| InChI | InChI=1S/C19H17NO3/c20-18(23)17-15(21)11-19(12-16(17)22,13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,17H,11-12H2,(H2,20,23) |
| InChIKey | PKRMPCDNBGNJHB-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dioxo-4,4-diphenylcyclohexane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dioxo-4,4-diphenylcyclohexane-1-carboxamide?
The IUPAC name of 2,6-dioxo-4,4-diphenylcyclohexane-1-carboxamide (CID 67153697) is 2,6-dioxo-4,4-diphenylcyclohexane-1-carboxamide.
What is the SMILES notation for 2,6-dioxo-4,4-diphenylcyclohexane-1-carboxamide?
The canonical SMILES for 2,6-dioxo-4,4-diphenylcyclohexane-1-carboxamide is NC(=O)C1C(=O)CC(c2ccccc2)(c2ccccc2)CC1=O.
What is the InChIKey of 2,6-dioxo-4,4-diphenylcyclohexane-1-carboxamide?
The InChIKey is PKRMPCDNBGNJHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17NO3/c20-18(23)17-15(21)11-19(12-16(17)22,13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,17H,11-12H2,(H2,20,23).
What are the key properties of 2,6-dioxo-4,4-diphenylcyclohexane-1-carboxamide?
2,6-dioxo-4,4-diphenylcyclohexane-1-carboxamide has a molecular weight of 307.35 g/mol, XLogP of 2.01, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dioxo-4,4-diphenylcyclohexane-1-carboxamide is sourced from PubChem (CID 67153697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).