About 1-N,1-N-bis(prop-2-enyl)cyclopentane-1,2-diamine
1-N,1-N-bis(prop-2-enyl)cyclopentane-1,2-diamine (PubChem CID 67153701) has the molecular formula C11H20N2
and a molecular weight of 180.30 g/mol. Its IUPAC name is 1-N,1-N-bis(prop-2-enyl)cyclopentane-1,2-diamine.
Molecular Properties
| Compound Name | 1-N,1-N-bis(prop-2-enyl)cyclopentane-1,2-diamine |
| PubChem CID | 67153701 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.30 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | 1-N,1-N-bis(prop-2-enyl)cyclopentane-1,2-diamine |
| SMILES | C=CCN(CC=C)C1CCCC1N |
| InChI | InChI=1S/C11H20N2/c1-3-8-13(9-4-2)11-7-5-6-10(11)12/h3-4,10-11H,1-2,5-9,12H2 |
| InChIKey | WYXADHFVZJUXPM-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.30 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-N,1-N-bis(prop-2-enyl)cyclopentane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N,1-N-bis(prop-2-enyl)cyclopentane-1,2-diamine?
The IUPAC name of 1-N,1-N-bis(prop-2-enyl)cyclopentane-1,2-diamine (CID 67153701) is 1-N,1-N-bis(prop-2-enyl)cyclopentane-1,2-diamine.
What is the SMILES notation for 1-N,1-N-bis(prop-2-enyl)cyclopentane-1,2-diamine?
The canonical SMILES for 1-N,1-N-bis(prop-2-enyl)cyclopentane-1,2-diamine is C=CCN(CC=C)C1CCCC1N.
What is the InChIKey of 1-N,1-N-bis(prop-2-enyl)cyclopentane-1,2-diamine?
The InChIKey is WYXADHFVZJUXPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2/c1-3-8-13(9-4-2)11-7-5-6-10(11)12/h3-4,10-11H,1-2,5-9,12H2.
What are the key properties of 1-N,1-N-bis(prop-2-enyl)cyclopentane-1,2-diamine?
1-N,1-N-bis(prop-2-enyl)cyclopentane-1,2-diamine has a molecular weight of 180.30 g/mol, XLogP of 1.54, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N,1-N-bis(prop-2-enyl)cyclopentane-1,2-diamine is sourced from PubChem (CID 67153701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).