About 4a,8a-dihydro-1H-pyrazino[2,3-b]pyrazin-2-one
4a,8a-dihydro-1H-pyrazino[2,3-b]pyrazin-2-one (PubChem CID 67153789) has the molecular formula C6H6N4O
and a molecular weight of 150.14 g/mol. Its IUPAC name is 4a,8a-dihydro-1H-pyrazino[2,3-b]pyrazin-2-one.
Molecular Properties
| Compound Name | 4a,8a-dihydro-1H-pyrazino[2,3-b]pyrazin-2-one |
| PubChem CID | 67153789 |
| Molecular Formula | C6H6N4O |
| Molecular Weight | 150.14 g/mol |
| Exact Mass | 150.05 |
| IUPAC Name | 4a,8a-dihydro-1H-pyrazino[2,3-b]pyrazin-2-one |
| SMILES | O=C1C=NC2N=CC=NC2N1 |
| InChI | InChI=1S/C6H6N4O/c11-4-3-9-5-6(10-4)8-2-1-7-5/h1-3,5-6H,(H,10,11) |
| InChIKey | BDRVPHYMAUNGHQ-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 66.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.14 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4a,8a-dihydro-1H-pyrazino[2,3-b]pyrazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4a,8a-dihydro-1H-pyrazino[2,3-b]pyrazin-2-one?
The IUPAC name of 4a,8a-dihydro-1H-pyrazino[2,3-b]pyrazin-2-one (CID 67153789) is 4a,8a-dihydro-1H-pyrazino[2,3-b]pyrazin-2-one.
What is the SMILES notation for 4a,8a-dihydro-1H-pyrazino[2,3-b]pyrazin-2-one?
The canonical SMILES for 4a,8a-dihydro-1H-pyrazino[2,3-b]pyrazin-2-one is O=C1C=NC2N=CC=NC2N1.
What is the InChIKey of 4a,8a-dihydro-1H-pyrazino[2,3-b]pyrazin-2-one?
The InChIKey is BDRVPHYMAUNGHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N4O/c11-4-3-9-5-6(10-4)8-2-1-7-5/h1-3,5-6H,(H,10,11).
What are the key properties of 4a,8a-dihydro-1H-pyrazino[2,3-b]pyrazin-2-one?
4a,8a-dihydro-1H-pyrazino[2,3-b]pyrazin-2-one has a molecular weight of 150.14 g/mol, XLogP of -1.01, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4a,8a-dihydro-1H-pyrazino[2,3-b]pyrazin-2-one is sourced from PubChem (CID 67153789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).