About imidazo[1,2-a]pyridine;phenylmethanamine
imidazo[1,2-a]pyridine;phenylmethanamine (PubChem CID 67154135) has the molecular formula C14H15N3
and a molecular weight of 225.30 g/mol. Its IUPAC name is imidazo[1,2-a]pyridine;phenylmethanamine.
Molecular Properties
| Compound Name | imidazo[1,2-a]pyridine;phenylmethanamine |
| PubChem CID | 67154135 |
| Molecular Formula | C14H15N3 |
| Molecular Weight | 225.30 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | imidazo[1,2-a]pyridine;phenylmethanamine |
| SMILES | NCc1ccccc1.c1ccn2ccnc2c1 |
| InChI | InChI=1S/C7H6N2.C7H9N/c1-2-5-9-6-4-8-7(9)3-1;8-6-7-4-2-1-3-5-7/h1-6H;1-5H,6,8H2 |
| InChIKey | BYMPZARMLZSPBE-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.30 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze imidazo[1,2-a]pyridine;phenylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of imidazo[1,2-a]pyridine;phenylmethanamine?
The IUPAC name of imidazo[1,2-a]pyridine;phenylmethanamine (CID 67154135) is imidazo[1,2-a]pyridine;phenylmethanamine.
What is the SMILES notation for imidazo[1,2-a]pyridine;phenylmethanamine?
The canonical SMILES for imidazo[1,2-a]pyridine;phenylmethanamine is NCc1ccccc1.c1ccn2ccnc2c1.
What is the InChIKey of imidazo[1,2-a]pyridine;phenylmethanamine?
The InChIKey is BYMPZARMLZSPBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2.C7H9N/c1-2-5-9-6-4-8-7(9)3-1;8-6-7-4-2-1-3-5-7/h1-6H;1-5H,6,8H2.
What are the key properties of imidazo[1,2-a]pyridine;phenylmethanamine?
imidazo[1,2-a]pyridine;phenylmethanamine has a molecular weight of 225.30 g/mol, XLogP of 2.48, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for imidazo[1,2-a]pyridine;phenylmethanamine is sourced from PubChem (CID 67154135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).