About 1-methyl-4-prop-2-enyl-4,5-dihydro-3H-1,2-thiazole
1-methyl-4-prop-2-enyl-4,5-dihydro-3H-1,2-thiazole (PubChem CID 67154371) has the molecular formula C7H13NS
and a molecular weight of 143.25 g/mol. Its IUPAC name is 1-methyl-4-prop-2-enyl-4,5-dihydro-3H-1,2-thiazole.
Molecular Properties
| Compound Name | 1-methyl-4-prop-2-enyl-4,5-dihydro-3H-1,2-thiazole |
| PubChem CID | 67154371 |
| Molecular Formula | C7H13NS |
| Molecular Weight | 143.25 g/mol |
| Exact Mass | 143.08 |
| IUPAC Name | 1-methyl-4-prop-2-enyl-4,5-dihydro-3H-1,2-thiazole |
| SMILES | C=CCC1CN=S(C)C1 |
| InChI | InChI=1S/C7H13NS/c1-3-4-7-5-8-9(2)6-7/h3,7H,1,4-6H2,2H3 |
| InChIKey | WDISWWZPKIJILV-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.25 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-4-prop-2-enyl-4,5-dihydro-3H-1,2-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-prop-2-enyl-4,5-dihydro-3H-1,2-thiazole?
The IUPAC name of 1-methyl-4-prop-2-enyl-4,5-dihydro-3H-1,2-thiazole (CID 67154371) is 1-methyl-4-prop-2-enyl-4,5-dihydro-3H-1,2-thiazole.
What is the SMILES notation for 1-methyl-4-prop-2-enyl-4,5-dihydro-3H-1,2-thiazole?
The canonical SMILES for 1-methyl-4-prop-2-enyl-4,5-dihydro-3H-1,2-thiazole is C=CCC1CN=S(C)C1.
What is the InChIKey of 1-methyl-4-prop-2-enyl-4,5-dihydro-3H-1,2-thiazole?
The InChIKey is WDISWWZPKIJILV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NS/c1-3-4-7-5-8-9(2)6-7/h3,7H,1,4-6H2,2H3.
What are the key properties of 1-methyl-4-prop-2-enyl-4,5-dihydro-3H-1,2-thiazole?
1-methyl-4-prop-2-enyl-4,5-dihydro-3H-1,2-thiazole has a molecular weight of 143.25 g/mol, XLogP of 1.62, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-prop-2-enyl-4,5-dihydro-3H-1,2-thiazole is sourced from PubChem (CID 67154371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).