About 6-bromo-3-(hydroxymethyl)-3,4-dihydro-1H-1,8-naphthyridin-2-one
6-bromo-3-(hydroxymethyl)-3,4-dihydro-1H-1,8-naphthyridin-2-one (PubChem CID 67154777) has the molecular formula C9H9BrN2O2
and a molecular weight of 257.09 g/mol. Its IUPAC name is 6-bromo-3-(hydroxymethyl)-3,4-dihydro-1H-1,8-naphthyridin-2-one.
Molecular Properties
| Compound Name | 6-bromo-3-(hydroxymethyl)-3,4-dihydro-1H-1,8-naphthyridin-2-one |
| PubChem CID | 67154777 |
| Molecular Formula | C9H9BrN2O2 |
| Molecular Weight | 257.09 g/mol |
| Exact Mass | 255.98 |
| IUPAC Name | 6-bromo-3-(hydroxymethyl)-3,4-dihydro-1H-1,8-naphthyridin-2-one |
| SMILES | O=C1Nc2ncc(Br)cc2CC1CO |
| InChI | InChI=1S/C9H9BrN2O2/c10-7-2-5-1-6(4-13)9(14)12-8(5)11-3-7/h2-3,6,13H,1,4H2,(H,11,12,14) |
| InChIKey | LCYCKIXATFRALF-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.09 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-bromo-3-(hydroxymethyl)-3,4-dihydro-1H-1,8-naphthyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-3-(hydroxymethyl)-3,4-dihydro-1H-1,8-naphthyridin-2-one?
The IUPAC name of 6-bromo-3-(hydroxymethyl)-3,4-dihydro-1H-1,8-naphthyridin-2-one (CID 67154777) is 6-bromo-3-(hydroxymethyl)-3,4-dihydro-1H-1,8-naphthyridin-2-one.
What is the SMILES notation for 6-bromo-3-(hydroxymethyl)-3,4-dihydro-1H-1,8-naphthyridin-2-one?
The canonical SMILES for 6-bromo-3-(hydroxymethyl)-3,4-dihydro-1H-1,8-naphthyridin-2-one is O=C1Nc2ncc(Br)cc2CC1CO.
What is the InChIKey of 6-bromo-3-(hydroxymethyl)-3,4-dihydro-1H-1,8-naphthyridin-2-one?
The InChIKey is LCYCKIXATFRALF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9BrN2O2/c10-7-2-5-1-6(4-13)9(14)12-8(5)11-3-7/h2-3,6,13H,1,4H2,(H,11,12,14).
What are the key properties of 6-bromo-3-(hydroxymethyl)-3,4-dihydro-1H-1,8-naphthyridin-2-one?
6-bromo-3-(hydroxymethyl)-3,4-dihydro-1H-1,8-naphthyridin-2-one has a molecular weight of 257.09 g/mol, XLogP of 0.95, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-3-(hydroxymethyl)-3,4-dihydro-1H-1,8-naphthyridin-2-one is sourced from PubChem (CID 67154777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).