C17H18F3N3O — CID 67154905
7-azabicyclo[2.2.1]heptane;3-[3-(trifluoromethyl)phenyl]-1H-pyridazin-6-one (PubChem CID 67154905) has the molecular formula C17H18F3N3O and a molecular weight of 337.35 g/mol. Its IUPAC name is 7-azabicyclo[2.2.1]heptane;3-[3-(trifluoromethyl)phenyl]-1H-pyridazin-6-one.
| Compound Name | 7-azabicyclo[2.2.1]heptane;3-[3-(trifluoromethyl)phenyl]-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 67154905 |
| Molecular Formula | C17H18F3N3O |
| Molecular Weight | 337.35 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | 7-azabicyclo[2.2.1]heptane;3-[3-(trifluoromethyl)phenyl]-1H-pyridazin-6-one |
| SMILES | C1CC2CCC1N2.O=c1ccc(-c2cccc(C(F)(F)F)c2)n[nH]1 |
| InChI | InChI=1S/C11H7F3N2O.C6H11N/c12-11(13,14)8-3-1-2-7(6-8)9-4-5-10(17)16-15-9;1-2-6-4-3-5(1)7-6/h1-6H,(H,16,17);5-7H,1-4H2 |
| InChIKey | QYAKUOIFASAHLX-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.35 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |