C12H22N4O4 — CID 67155036
(2S)-2-amino-4-[(4-oxo-4-piperazin-1-ylbutanoyl)amino]butanoic acid (PubChem CID 67155036) has the molecular formula C12H22N4O4 and a molecular weight of 286.33 g/mol. Its IUPAC name is (2S)-2-amino-4-[(4-oxo-4-piperazin-1-ylbutanoyl)amino]butanoic acid.
| Compound Name | (2S)-2-amino-4-[(4-oxo-4-piperazin-1-ylbutanoyl)amino]butanoic acid |
|---|---|
| PubChem CID | 67155036 |
| Molecular Formula | C12H22N4O4 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | (2S)-2-amino-4-[(4-oxo-4-piperazin-1-ylbutanoyl)amino]butanoic acid |
| SMILES | N[C@@H](CCNC(=O)CCC(=O)N1CCNCC1)C(=O)O |
| InChI | InChI=1S/C12H22N4O4/c13-9(12(19)20)3-4-15-10(17)1-2-11(18)16-7-5-14-6-8-16/h9,14H,1-8,13H2,(H,15,17)(H,19,20)/t9-/m0/s1 |
| InChIKey | XIVCFMOAHUNVSE-VIFPVBQESA-N |
| XLogP | -1.88 |
| TPSA | 124.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |