About cis-(1S,2R)-2-(ethylamino)-5,5-difluorocyclohexane-1-carboxylic acid
cis-(1S,2R)-2-(ethylamino)-5,5-difluorocyclohexane-1-carboxylic acid (PubChem CID 67155186) has the molecular formula C9H15F2NO2
and a molecular weight of 207.22 g/mol. Its IUPAC name is cis-(1S,2R)-2-(ethylamino)-5,5-difluorocyclohexane-1-carboxylic acid.
Molecular Properties
| Compound Name | cis-(1S,2R)-2-(ethylamino)-5,5-difluorocyclohexane-1-carboxylic acid |
| PubChem CID | 67155186 |
| Molecular Formula | C9H15F2NO2 |
| Molecular Weight | 207.22 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | cis-(1S,2R)-2-(ethylamino)-5,5-difluorocyclohexane-1-carboxylic acid |
| SMILES | CCN[C@@H]1CCC(F)(F)C[C@@H]1C(=O)O |
| InChI | InChI=1S/C9H15F2NO2/c1-2-12-7-3-4-9(10,11)5-6(7)8(13)14/h6-7,12H,2-5H2,1H3,(H,13,14)/t6-,7+/m0/s1 |
| InChIKey | VGSSQFSLMKHMGM-NKWVEPMBSA-N |
| XLogP | 1.48 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.22 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cis-(1S,2R)-2-(ethylamino)-5,5-difluorocyclohexane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1S,2R)-2-(ethylamino)-5,5-difluorocyclohexane-1-carboxylic acid?
The IUPAC name of cis-(1S,2R)-2-(ethylamino)-5,5-difluorocyclohexane-1-carboxylic acid (CID 67155186) is cis-(1S,2R)-2-(ethylamino)-5,5-difluorocyclohexane-1-carboxylic acid.
What is the SMILES notation for cis-(1S,2R)-2-(ethylamino)-5,5-difluorocyclohexane-1-carboxylic acid?
The canonical SMILES for cis-(1S,2R)-2-(ethylamino)-5,5-difluorocyclohexane-1-carboxylic acid is CCN[C@@H]1CCC(F)(F)C[C@@H]1C(=O)O.
What is the InChIKey of cis-(1S,2R)-2-(ethylamino)-5,5-difluorocyclohexane-1-carboxylic acid?
The InChIKey is VGSSQFSLMKHMGM-NKWVEPMBSA-N. The full InChI is InChI=1S/C9H15F2NO2/c1-2-12-7-3-4-9(10,11)5-6(7)8(13)14/h6-7,12H,2-5H2,1H3,(H,13,14)/t6-,7+/m0/s1.
What are the key properties of cis-(1S,2R)-2-(ethylamino)-5,5-difluorocyclohexane-1-carboxylic acid?
cis-(1S,2R)-2-(ethylamino)-5,5-difluorocyclohexane-1-carboxylic acid has a molecular weight of 207.22 g/mol, XLogP of 1.48, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1S,2R)-2-(ethylamino)-5,5-difluorocyclohexane-1-carboxylic acid is sourced from PubChem (CID 67155186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).