About (5-hydroxy-2-adamantyl) 3-[(5-cyano-2-pyridinyl)amino]pyrrolidine-1-carboxylate
(5-hydroxy-2-adamantyl) 3-[(5-cyano-2-pyridinyl)amino]pyrrolidine-1-carboxylate (PubChem CID 67155545) has the molecular formula C21H26N4O3
and a molecular weight of 382.46 g/mol. Its IUPAC name is (5-hydroxy-2-adamantyl) 3-[(5-cyano-2-pyridinyl)amino]pyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | (5-hydroxy-2-adamantyl) 3-[(5-cyano-2-pyridinyl)amino]pyrrolidine-1-carboxylate |
| PubChem CID | 67155545 |
| Molecular Formula | C21H26N4O3 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | (5-hydroxy-2-adamantyl) 3-[(5-cyano-2-pyridinyl)amino]pyrrolidine-1-carboxylate |
| SMILES | N#Cc1ccc(NC2CCN(C(=O)OC3C4CC5CC3CC(O)(C5)C4)C2)nc1 |
| InChI | InChI=1S/C21H26N4O3/c22-10-13-1-2-18(23-11-13)24-17-3-4-25(12-17)20(26)28-19-15-5-14-6-16(19)9-21(27,7-14)8-15/h1-2,11,14-17,19,27H,3-9,12H2,(H,23,24) |
| InChIKey | GQHLPXNZJIGNDO-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 98.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (5-hydroxy-2-adamantyl) 3-[(5-cyano-2-pyridinyl)amino]pyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-hydroxy-2-adamantyl) 3-[(5-cyano-2-pyridinyl)amino]pyrrolidine-1-carboxylate?
The IUPAC name of (5-hydroxy-2-adamantyl) 3-[(5-cyano-2-pyridinyl)amino]pyrrolidine-1-carboxylate (CID 67155545) is (5-hydroxy-2-adamantyl) 3-[(5-cyano-2-pyridinyl)amino]pyrrolidine-1-carboxylate.
What is the SMILES notation for (5-hydroxy-2-adamantyl) 3-[(5-cyano-2-pyridinyl)amino]pyrrolidine-1-carboxylate?
The canonical SMILES for (5-hydroxy-2-adamantyl) 3-[(5-cyano-2-pyridinyl)amino]pyrrolidine-1-carboxylate is N#Cc1ccc(NC2CCN(C(=O)OC3C4CC5CC3CC(O)(C5)C4)C2)nc1.
What is the InChIKey of (5-hydroxy-2-adamantyl) 3-[(5-cyano-2-pyridinyl)amino]pyrrolidine-1-carboxylate?
The InChIKey is GQHLPXNZJIGNDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26N4O3/c22-10-13-1-2-18(23-11-13)24-17-3-4-25(12-17)20(26)28-19-15-5-14-6-16(19)9-21(27,7-14)8-15/h1-2,11,14-17,19,27H,3-9,12H2,(H,23,24).
What are the key properties of (5-hydroxy-2-adamantyl) 3-[(5-cyano-2-pyridinyl)amino]pyrrolidine-1-carboxylate?
(5-hydroxy-2-adamantyl) 3-[(5-cyano-2-pyridinyl)amino]pyrrolidine-1-carboxylate has a molecular weight of 382.46 g/mol, XLogP of 2.52, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (5-hydroxy-2-adamantyl) 3-[(5-cyano-2-pyridinyl)amino]pyrrolidine-1-carboxylate is sourced from PubChem (CID 67155545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).