C13H22N6 — CID 67156464
5-ethyl-6-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)pyrimidine-2,4-diamine (PubChem CID 67156464) has the molecular formula C13H22N6 and a molecular weight of 262.36 g/mol. Its IUPAC name is 5-ethyl-6-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)pyrimidine-2,4-diamine.
| Compound Name | 5-ethyl-6-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 67156464 |
| Molecular Formula | C13H22N6 |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | 5-ethyl-6-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)pyrimidine-2,4-diamine |
| SMILES | CCc1c(N)nc(N)nc1N1CC2CN(C)CC2C1 |
| InChI | InChI=1S/C13H22N6/c1-3-10-11(14)16-13(15)17-12(10)19-6-8-4-18(2)5-9(8)7-19/h8-9H,3-7H2,1-2H3,(H4,14,15,16,17) |
| InChIKey | DVIFCQCDVNDELF-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |