C14H22N6 — CID 67156514
5-cyclopropyl-6-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)pyrimidine-2,4-diamine (PubChem CID 67156514) has the molecular formula C14H22N6 and a molecular weight of 274.37 g/mol. Its IUPAC name is 5-cyclopropyl-6-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)pyrimidine-2,4-diamine.
| Compound Name | 5-cyclopropyl-6-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 67156514 |
| Molecular Formula | C14H22N6 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | 5-cyclopropyl-6-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)pyrimidine-2,4-diamine |
| SMILES | CN1CC2CN(c3nc(N)nc(N)c3C3CC3)CC2C1 |
| InChI | InChI=1S/C14H22N6/c1-19-4-9-6-20(7-10(9)5-19)13-11(8-2-3-8)12(15)17-14(16)18-13/h8-10H,2-7H2,1H3,(H4,15,16,17,18) |
| InChIKey | XTRKCIKGAMFAOO-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |