C19H21N5O2 — CID 67156541
3-[(16S)-9-amino-16-methyl-14-oxa-8,11,17-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),3,5,8,11-hexaen-5-yl]-N,N-dimethylprop-2-enamide (PubChem CID 67156541) has the molecular formula C19H21N5O2 and a molecular weight of 351.41 g/mol. Its IUPAC name is 3-[(16S)-9-amino-16-methyl-14-oxa-8,11,17-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),3,5,8,11-hexaen-5-yl]-N,N-dimethylprop-2-enamide.
| Compound Name | 3-[(16S)-9-amino-16-methyl-14-oxa-8,11,17-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),3,5,8,11-hexaen-5-yl]-N,N-dimethylprop-2-enamide |
|---|---|
| PubChem CID | 67156541 |
| Molecular Formula | C19H21N5O2 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | 3-[(16S)-9-amino-16-methyl-14-oxa-8,11,17-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),3,5,8,11-hexaen-5-yl]-N,N-dimethylprop-2-enamide |
| SMILES | C[C@H]1COCc2nc3c(N)nc4cc(C=CC(=O)N(C)C)ccc4c3n21 |
| InChI | InChI=1S/C19H21N5O2/c1-11-9-26-10-15-22-17-18(24(11)15)13-6-4-12(5-7-16(25)23(2)3)8-14(13)21-19(17)20/h4-8,11H,9-10H2,1-3H3,(H2,20,21)/t11-/m0/s1 |
| InChIKey | ZKNASHFKDZXXPW-NSHDSACASA-N |
| XLogP | 2.36 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|