About 1-(2-chloro-4-fluorophenyl)sulfonyl-4-piperazin-1-ylpyrrolo[3,2-c]pyridine;hydrochloride
1-(2-chloro-4-fluorophenyl)sulfonyl-4-piperazin-1-ylpyrrolo[3,2-c]pyridine;hydrochloride (PubChem CID 67156863) has the molecular formula C17H17Cl2FN4O2S
and a molecular weight of 431.32 g/mol. Its IUPAC name is 1-(2-chloro-4-fluorophenyl)sulfonyl-4-piperazin-1-ylpyrrolo[3,2-c]pyridine;hydrochloride.
Molecular Properties
| Compound Name | 1-(2-chloro-4-fluorophenyl)sulfonyl-4-piperazin-1-ylpyrrolo[3,2-c]pyridine;hydrochloride |
| PubChem CID | 67156863 |
| Molecular Formula | C17H17Cl2FN4O2S |
| Molecular Weight | 431.32 g/mol |
| Exact Mass | 430.04 |
| IUPAC Name | 1-(2-chloro-4-fluorophenyl)sulfonyl-4-piperazin-1-ylpyrrolo[3,2-c]pyridine;hydrochloride |
| SMILES | Cl.O=S(=O)(c1ccc(F)cc1Cl)n1ccc2c(N3CCNCC3)nccc21 |
| InChI | InChI=1S/C17H16ClFN4O2S.ClH/c18-14-11-12(19)1-2-16(14)26(24,25)23-8-4-13-15(23)3-5-21-17(13)22-9-6-20-7-10-22;/h1-5,8,11,20H,6-7,9-10H2;1H |
| InChIKey | MNFGZQFCDOWICP-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 431.32 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(2-chloro-4-fluorophenyl)sulfonyl-4-piperazin-1-ylpyrrolo[3,2-c]pyridine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-chloro-4-fluorophenyl)sulfonyl-4-piperazin-1-ylpyrrolo[3,2-c]pyridine;hydrochloride?
The IUPAC name of 1-(2-chloro-4-fluorophenyl)sulfonyl-4-piperazin-1-ylpyrrolo[3,2-c]pyridine;hydrochloride (CID 67156863) is 1-(2-chloro-4-fluorophenyl)sulfonyl-4-piperazin-1-ylpyrrolo[3,2-c]pyridine;hydrochloride.
What is the SMILES notation for 1-(2-chloro-4-fluorophenyl)sulfonyl-4-piperazin-1-ylpyrrolo[3,2-c]pyridine;hydrochloride?
The canonical SMILES for 1-(2-chloro-4-fluorophenyl)sulfonyl-4-piperazin-1-ylpyrrolo[3,2-c]pyridine;hydrochloride is Cl.O=S(=O)(c1ccc(F)cc1Cl)n1ccc2c(N3CCNCC3)nccc21.
What is the InChIKey of 1-(2-chloro-4-fluorophenyl)sulfonyl-4-piperazin-1-ylpyrrolo[3,2-c]pyridine;hydrochloride?
The InChIKey is MNFGZQFCDOWICP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16ClFN4O2S.ClH/c18-14-11-12(19)1-2-16(14)26(24,25)23-8-4-13-15(23)3-5-21-17(13)22-9-6-20-7-10-22;/h1-5,8,11,20H,6-7,9-10H2;1H.
What are the key properties of 1-(2-chloro-4-fluorophenyl)sulfonyl-4-piperazin-1-ylpyrrolo[3,2-c]pyridine;hydrochloride?
1-(2-chloro-4-fluorophenyl)sulfonyl-4-piperazin-1-ylpyrrolo[3,2-c]pyridine;hydrochloride has a molecular weight of 431.32 g/mol, XLogP of 2.90, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-chloro-4-fluorophenyl)sulfonyl-4-piperazin-1-ylpyrrolo[3,2-c]pyridine;hydrochloride is sourced from PubChem (CID 67156863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).