C50H54F2O9 — CID 67157693
(2S,3S,4S,5R,6S)-2-(fluoromethyl)-3-[(2R,3R,4S,5S,6S)-6-(fluoromethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxy-4,5-bis(phenylmethoxy)-6-prop-2-enoxyoxane (PubChem CID 67157693) has the molecular formula C50H54F2O9 and a molecular weight of 836.97 g/mol. Its IUPAC name is (2S,3S,4S,5R,6S)-2-(fluoromethyl)-3-[(2R,3R,4S,5S,6S)-6-(fluoromethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxy-4,5-bis(phenylmethoxy)-6-prop-2-enoxyoxane.
| Compound Name | (2S,3S,4S,5R,6S)-2-(fluoromethyl)-3-[(2R,3R,4S,5S,6S)-6-(fluoromethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxy-4,5-bis(phenylmethoxy)-6-prop-2-enoxyoxane |
|---|---|
| PubChem CID | 67157693 |
| Molecular Formula | C50H54F2O9 |
| Molecular Weight | 836.97 g/mol |
| Exact Mass | 836.37 |
| IUPAC Name | (2S,3S,4S,5R,6S)-2-(fluoromethyl)-3-[(2R,3R,4S,5S,6S)-6-(fluoromethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxy-4,5-bis(phenylmethoxy)-6-prop-2-enoxyoxane |
| SMILES | C=CCO[C@H]1O[C@H](CF)[C@@H](O[C@@H]2O[C@H](CF)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]2OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C50H54F2O9/c1-2-28-53-49-47(57-34-39-24-14-6-15-25-39)46(56-33-38-22-12-5-13-23-38)44(42(30-52)59-49)61-50-48(58-35-40-26-16-7-17-27-40)45(55-32-37-20-10-4-11-21-37)43(41(29-51)60-50)54-31-36-18-8-3-9-19-36/h2-27,41-50H,1,28-35H2/t41-,42-,43-,44-,45+,46+,47-,48-,49+,50+/m1/s1 |
| InChIKey | ZQHHVNXNIDVKEN-IEUOUCAXSA-N |
| XLogP | 8.89 |
| TPSA | 83.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 836.97 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|