C28H25FN4O5 — CID 67158686
[(2S)-2-[[5-(3-fluorophenyl)-1,3,4-oxadiazol-2-yl]methyl]piperidin-1-yl]-[2-(4-methoxyphenyl)-5-nitrophenyl]methanone (PubChem CID 67158686) has the molecular formula C28H25FN4O5 and a molecular weight of 516.53 g/mol. Its IUPAC name is [(2S)-2-[[5-(3-fluorophenyl)-1,3,4-oxadiazol-2-yl]methyl]piperidin-1-yl]-[2-(4-methoxyphenyl)-5-nitrophenyl]methanone.
| Compound Name | [(2S)-2-[[5-(3-fluorophenyl)-1,3,4-oxadiazol-2-yl]methyl]piperidin-1-yl]-[2-(4-methoxyphenyl)-5-nitrophenyl]methanone |
|---|---|
| PubChem CID | 67158686 |
| Molecular Formula | C28H25FN4O5 |
| Molecular Weight | 516.53 g/mol |
| Exact Mass | 516.18 |
| IUPAC Name | [(2S)-2-[[5-(3-fluorophenyl)-1,3,4-oxadiazol-2-yl]methyl]piperidin-1-yl]-[2-(4-methoxyphenyl)-5-nitrophenyl]methanone |
| SMILES | COc1ccc(-c2ccc([N+](=O)[O-])cc2C(=O)N2CCCC[C@H]2Cc2nnc(-c3cccc(F)c3)o2)cc1 |
| InChI | InChI=1S/C28H25FN4O5/c1-37-23-11-8-18(9-12-23)24-13-10-22(33(35)36)16-25(24)28(34)32-14-3-2-7-21(32)17-26-30-31-27(38-26)19-5-4-6-20(29)15-19/h4-6,8-13,15-16,21H,2-3,7,14,17H2,1H3/t21-/m0/s1 |
| InChIKey | WYSLXNYISXCCEH-NRFANRHFSA-N |
| XLogP | 5.70 |
| TPSA | 111.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.53 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|