C20H27Cl2O6P — CID 67158781
methyl 6-(3,4-dichlorophenyl)-2-diethoxyphosphoryloxy-4,6-dimethylcyclohexene-1-carboxylate (PubChem CID 67158781) has the molecular formula C20H27Cl2O6P and a molecular weight of 465.31 g/mol. Its IUPAC name is methyl 6-(3,4-dichlorophenyl)-2-diethoxyphosphoryloxy-4,6-dimethylcyclohexene-1-carboxylate.
| Compound Name | methyl 6-(3,4-dichlorophenyl)-2-diethoxyphosphoryloxy-4,6-dimethylcyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 67158781 |
| Molecular Formula | C20H27Cl2O6P |
| Molecular Weight | 465.31 g/mol |
| Exact Mass | 464.09 |
| IUPAC Name | methyl 6-(3,4-dichlorophenyl)-2-diethoxyphosphoryloxy-4,6-dimethylcyclohexene-1-carboxylate |
| SMILES | CCOP(=O)(OCC)OC1=C(C(=O)OC)C(C)(c2ccc(Cl)c(Cl)c2)CC(C)C1 |
| InChI | InChI=1S/C20H27Cl2O6P/c1-6-26-29(24,27-7-2)28-17-10-13(3)12-20(4,18(17)19(23)25-5)14-8-9-15(21)16(22)11-14/h8-9,11,13H,6-7,10,12H2,1-5H3 |
| InChIKey | VKEHBYRQXHEXFT-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.31 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|