About azane;2-ethylmorpholine;2-methyl-1-propylpiperidine;4-methyl-1-propylpiperidine
azane;2-ethylmorpholine;2-methyl-1-propylpiperidine;4-methyl-1-propylpiperidine (PubChem CID 67158808) has the molecular formula C24H60N6O
and a molecular weight of 448.79 g/mol. Its IUPAC name is azane;2-ethylmorpholine;2-methyl-1-propylpiperidine;4-methyl-1-propylpiperidine.
Molecular Properties
| Compound Name | azane;2-ethylmorpholine;2-methyl-1-propylpiperidine;4-methyl-1-propylpiperidine |
| PubChem CID | 67158808 |
| Molecular Formula | C24H60N6O |
| Molecular Weight | 448.79 g/mol |
| Exact Mass | 448.48 |
| IUPAC Name | azane;2-ethylmorpholine;2-methyl-1-propylpiperidine;4-methyl-1-propylpiperidine |
| SMILES | CCC1CNCCO1.CCCN1CCC(C)CC1.CCCN1CCCCC1C.N.N.N |
| InChI | InChI=1S/2C9H19N.C6H13NO.3H3N/c1-3-6-10-7-4-9(2)5-8-10;1-3-7-10-8-5-4-6-9(10)2;1-2-6-5-7-3-4-8-6;;;/h2*9H,3-8H2,1-2H3;6-7H,2-5H2,1H3;3*1H3 |
| InChIKey | YORVQDLFVSLMSL-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 132.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 448.79 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze azane;2-ethylmorpholine;2-methyl-1-propylpiperidine;4-methyl-1-propylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;2-ethylmorpholine;2-methyl-1-propylpiperidine;4-methyl-1-propylpiperidine?
The IUPAC name of azane;2-ethylmorpholine;2-methyl-1-propylpiperidine;4-methyl-1-propylpiperidine (CID 67158808) is azane;2-ethylmorpholine;2-methyl-1-propylpiperidine;4-methyl-1-propylpiperidine.
What is the SMILES notation for azane;2-ethylmorpholine;2-methyl-1-propylpiperidine;4-methyl-1-propylpiperidine?
The canonical SMILES for azane;2-ethylmorpholine;2-methyl-1-propylpiperidine;4-methyl-1-propylpiperidine is CCC1CNCCO1.CCCN1CCC(C)CC1.CCCN1CCCCC1C.N.N.N.
What is the InChIKey of azane;2-ethylmorpholine;2-methyl-1-propylpiperidine;4-methyl-1-propylpiperidine?
The InChIKey is YORVQDLFVSLMSL-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H19N.C6H13NO.3H3N/c1-3-6-10-7-4-9(2)5-8-10;1-3-7-10-8-5-4-6-9(10)2;1-2-6-5-7-3-4-8-6;;;/h2*9H,3-8H2,1-2H3;6-7H,2-5H2,1H3;3*1H3.
What are the key properties of azane;2-ethylmorpholine;2-methyl-1-propylpiperidine;4-methyl-1-propylpiperidine?
azane;2-ethylmorpholine;2-methyl-1-propylpiperidine;4-methyl-1-propylpiperidine has a molecular weight of 448.79 g/mol, XLogP of 5.27, 5 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2-ethylmorpholine;2-methyl-1-propylpiperidine;4-methyl-1-propylpiperidine is sourced from PubChem (CID 67158808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).