C21H30N2 — CID 67159344
N'-(1-adamantyl)-N'-[(1R,2S)-2-phenylcyclopropyl]ethane-1,2-diamine (PubChem CID 67159344) has the molecular formula C21H30N2 and a molecular weight of 310.48 g/mol. Its IUPAC name is N'-(1-adamantyl)-N'-[(1R,2S)-2-phenylcyclopropyl]ethane-1,2-diamine.
| Compound Name | N'-(1-adamantyl)-N'-[(1R,2S)-2-phenylcyclopropyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 67159344 |
| Molecular Formula | C21H30N2 |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.24 |
| IUPAC Name | N'-(1-adamantyl)-N'-[(1R,2S)-2-phenylcyclopropyl]ethane-1,2-diamine |
| SMILES | NCCN([C@@H]1C[C@H]1c1ccccc1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C21H30N2/c22-6-7-23(20-11-19(20)18-4-2-1-3-5-18)21-12-15-8-16(13-21)10-17(9-15)14-21/h1-5,15-17,19-20H,6-14,22H2/t15?,16?,17?,19-,20+,21?/m0/s1 |
| InChIKey | PPIXDKQIKQQIHU-BVZWOAMPSA-N |
| XLogP | 3.77 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |