C15H23N3O4 — CID 67159419
ditert-butyl 2-hydrazinylpyridine-3,4-dicarboxylate (PubChem CID 67159419) has the molecular formula C15H23N3O4 and a molecular weight of 309.37 g/mol. Its IUPAC name is ditert-butyl 2-hydrazinylpyridine-3,4-dicarboxylate.
| Compound Name | ditert-butyl 2-hydrazinylpyridine-3,4-dicarboxylate |
|---|---|
| PubChem CID | 67159419 |
| Molecular Formula | C15H23N3O4 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | ditert-butyl 2-hydrazinylpyridine-3,4-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)c1ccnc(NN)c1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H23N3O4/c1-14(2,3)21-12(19)9-7-8-17-11(18-16)10(9)13(20)22-15(4,5)6/h7-8H,16H2,1-6H3,(H,17,18) |
| InChIKey | GWULNEDBVQYFHK-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|