About 1,2,3-benzoxathiazin-4-amine
1,2,3-benzoxathiazin-4-amine (PubChem CID 67159512) has the molecular formula C7H6N2OS
and a molecular weight of 166.21 g/mol. Its IUPAC name is 1,2,3-benzoxathiazin-4-amine.
Molecular Properties
| Compound Name | 1,2,3-benzoxathiazin-4-amine |
| PubChem CID | 67159512 |
| Molecular Formula | C7H6N2OS |
| Molecular Weight | 166.21 g/mol |
| Exact Mass | 166.02 |
| IUPAC Name | 1,2,3-benzoxathiazin-4-amine |
| SMILES | NC1=NSOc2ccccc21 |
| InChI | InChI=1S/C7H6N2OS/c8-7-5-3-1-2-4-6(5)10-11-9-7/h1-4H,(H2,8,9) |
| InChIKey | QUWFXNLXRMIIOT-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.21 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,2,3-benzoxathiazin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,3-benzoxathiazin-4-amine?
The IUPAC name of 1,2,3-benzoxathiazin-4-amine (CID 67159512) is 1,2,3-benzoxathiazin-4-amine.
What is the SMILES notation for 1,2,3-benzoxathiazin-4-amine?
The canonical SMILES for 1,2,3-benzoxathiazin-4-amine is NC1=NSOc2ccccc21.
What is the InChIKey of 1,2,3-benzoxathiazin-4-amine?
The InChIKey is QUWFXNLXRMIIOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2OS/c8-7-5-3-1-2-4-6(5)10-11-9-7/h1-4H,(H2,8,9).
What are the key properties of 1,2,3-benzoxathiazin-4-amine?
1,2,3-benzoxathiazin-4-amine has a molecular weight of 166.21 g/mol, XLogP of 1.35, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,3-benzoxathiazin-4-amine is sourced from PubChem (CID 67159512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).