C24H19F2N4O+ — CID 67159562
N-[5-(1-benzyl-4-methylpyridin-1-ium-3-yl)pyrazin-2-yl]-2,6-difluorobenzamide (PubChem CID 67159562) has the molecular formula C24H19F2N4O+ and a molecular weight of 417.44 g/mol. Its IUPAC name is N-[5-(1-benzyl-4-methylpyridin-1-ium-3-yl)pyrazin-2-yl]-2,6-difluorobenzamide.
| Compound Name | N-[5-(1-benzyl-4-methylpyridin-1-ium-3-yl)pyrazin-2-yl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 67159562 |
| Molecular Formula | C24H19F2N4O+ |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | N-[5-(1-benzyl-4-methylpyridin-1-ium-3-yl)pyrazin-2-yl]-2,6-difluorobenzamide |
| SMILES | Cc1cc[n+](Cc2ccccc2)cc1-c1cnc(NC(=O)c2c(F)cccc2F)cn1 |
| InChI | InChI=1S/C24H18F2N4O/c1-16-10-11-30(14-17-6-3-2-4-7-17)15-18(16)21-12-28-22(13-27-21)29-24(31)23-19(25)8-5-9-20(23)26/h2-13,15H,14H2,1H3/p+1 |
| InChIKey | NXXQTABTCFDYCI-UHFFFAOYSA-O |
| XLogP | 4.32 |
| TPSA | 58.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|