C26H29BrF3N3O4S — CID 67159974
4-bromobenzamide;4-[5-[(3-methylbutylamino)methyl]thiophen-2-yl]benzamide;2,2,2-trifluoroacetic acid (PubChem CID 67159974) has the molecular formula C26H29BrF3N3O4S and a molecular weight of 616.50 g/mol. Its IUPAC name is 4-bromobenzamide;4-[5-[(3-methylbutylamino)methyl]thiophen-2-yl]benzamide;2,2,2-trifluoroacetic acid.
| Compound Name | 4-bromobenzamide;4-[5-[(3-methylbutylamino)methyl]thiophen-2-yl]benzamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67159974 |
| Molecular Formula | C26H29BrF3N3O4S |
| Molecular Weight | 616.50 g/mol |
| Exact Mass | 615.10 |
| IUPAC Name | 4-bromobenzamide;4-[5-[(3-methylbutylamino)methyl]thiophen-2-yl]benzamide;2,2,2-trifluoroacetic acid |
| SMILES | CC(C)CCNCc1ccc(-c2ccc(C(N)=O)cc2)s1.NC(=O)c1ccc(Br)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H22N2OS.C7H6BrNO.C2HF3O2/c1-12(2)9-10-19-11-15-7-8-16(21-15)13-3-5-14(6-4-13)17(18)20;8-6-3-1-5(2-4-6)7(9)10;3-2(4,5)1(6)7/h3-8,12,19H,9-11H2,1-2H3,(H2,18,20);1-4H,(H2,9,10);(H,6,7) |
| InChIKey | AESRZSQLGTZAAY-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 135.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.50 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|