C18H23F2NO3 — CID 67160009
2-[4-(4,4-difluoropiperidin-1-yl)-4-oxobutyl]-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione (PubChem CID 67160009) has the molecular formula C18H23F2NO3 and a molecular weight of 339.38 g/mol. Its IUPAC name is 2-[4-(4,4-difluoropiperidin-1-yl)-4-oxobutyl]-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-[4-(4,4-difluoropiperidin-1-yl)-4-oxobutyl]-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 67160009 |
| Molecular Formula | C18H23F2NO3 |
| Molecular Weight | 339.38 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 2-[4-(4,4-difluoropiperidin-1-yl)-4-oxobutyl]-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione |
| SMILES | CC1=C(C)C(=O)C(CCCC(=O)N2CCC(F)(F)CC2)=C(C)C1=O |
| InChI | InChI=1S/C18H23F2NO3/c1-11-12(2)17(24)14(13(3)16(11)23)5-4-6-15(22)21-9-7-18(19,20)8-10-21/h4-10H2,1-3H3 |
| InChIKey | UAIPDZIGPZFKGL-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.38 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|