About 8-methoxy-N,N-bis(prop-2-enyl)quinoline-5-sulfonamide
8-methoxy-N,N-bis(prop-2-enyl)quinoline-5-sulfonamide (PubChem CID 671601) has the molecular formula C16H18N2O3S
and a molecular weight of 318.40 g/mol. Its IUPAC name is 8-methoxy-N,N-bis(prop-2-enyl)quinoline-5-sulfonamide.
Molecular Properties
| Compound Name | 8-methoxy-N,N-bis(prop-2-enyl)quinoline-5-sulfonamide |
| PubChem CID | 671601 |
| Molecular Formula | C16H18N2O3S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 8-methoxy-N,N-bis(prop-2-enyl)quinoline-5-sulfonamide |
| SMILES | C=CCN(CC=C)S(=O)(=O)c1ccc(OC)c2ncccc12 |
| InChI | InChI=1S/C16H18N2O3S/c1-4-11-18(12-5-2)22(19,20)15-9-8-14(21-3)16-13(15)7-6-10-17-16/h4-10H,1-2,11-12H2,3H3 |
| InChIKey | WPZXULIAUBAUGW-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 8-methoxy-N,N-bis(prop-2-enyl)quinoline-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methoxy-N,N-bis(prop-2-enyl)quinoline-5-sulfonamide?
The IUPAC name of 8-methoxy-N,N-bis(prop-2-enyl)quinoline-5-sulfonamide (CID 671601) is 8-methoxy-N,N-bis(prop-2-enyl)quinoline-5-sulfonamide.
What is the SMILES notation for 8-methoxy-N,N-bis(prop-2-enyl)quinoline-5-sulfonamide?
The canonical SMILES for 8-methoxy-N,N-bis(prop-2-enyl)quinoline-5-sulfonamide is C=CCN(CC=C)S(=O)(=O)c1ccc(OC)c2ncccc12.
What is the InChIKey of 8-methoxy-N,N-bis(prop-2-enyl)quinoline-5-sulfonamide?
The InChIKey is WPZXULIAUBAUGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O3S/c1-4-11-18(12-5-2)22(19,20)15-9-8-14(21-3)16-13(15)7-6-10-17-16/h4-10H,1-2,11-12H2,3H3.
What are the key properties of 8-methoxy-N,N-bis(prop-2-enyl)quinoline-5-sulfonamide?
8-methoxy-N,N-bis(prop-2-enyl)quinoline-5-sulfonamide has a molecular weight of 318.40 g/mol, XLogP of 2.61, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methoxy-N,N-bis(prop-2-enyl)quinoline-5-sulfonamide is sourced from PubChem (CID 671601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).