C13H17NO4 — CID 67160305
4-(2-methoxy-4,5-dimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)butanamide (PubChem CID 67160305) has the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. Its IUPAC name is 4-(2-methoxy-4,5-dimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)butanamide.
| Compound Name | 4-(2-methoxy-4,5-dimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)butanamide |
|---|---|
| PubChem CID | 67160305 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 4-(2-methoxy-4,5-dimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)butanamide |
| SMILES | COC1=C(CCCC(N)=O)C(=O)C(C)=C(C)C1=O |
| InChI | InChI=1S/C13H17NO4/c1-7-8(2)12(17)13(18-3)9(11(7)16)5-4-6-10(14)15/h4-6H2,1-3H3,(H2,14,15) |
| InChIKey | LIQJWWJHHXWZHP-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|