About 1-fluoroethyl (2,4,5-tritert-butylphenyl) carbonate
1-fluoroethyl (2,4,5-tritert-butylphenyl) carbonate (PubChem CID 67160861) has the molecular formula C21H33FO3
and a molecular weight of 352.49 g/mol. Its IUPAC name is 1-fluoroethyl (2,4,5-tritert-butylphenyl) carbonate.
Molecular Properties
| Compound Name | 1-fluoroethyl (2,4,5-tritert-butylphenyl) carbonate |
| PubChem CID | 67160861 |
| Molecular Formula | C21H33FO3 |
| Molecular Weight | 352.49 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | 1-fluoroethyl (2,4,5-tritert-butylphenyl) carbonate |
| SMILES | CC(F)OC(=O)Oc1cc(C(C)(C)C)c(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C21H33FO3/c1-13(22)24-18(23)25-17-12-15(20(5,6)7)14(19(2,3)4)11-16(17)21(8,9)10/h11-13H,1-10H3 |
| InChIKey | WBOFINDHEOVVLH-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 352.49 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze 1-fluoroethyl (2,4,5-tritert-butylphenyl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoroethyl (2,4,5-tritert-butylphenyl) carbonate?
The IUPAC name of 1-fluoroethyl (2,4,5-tritert-butylphenyl) carbonate (CID 67160861) is 1-fluoroethyl (2,4,5-tritert-butylphenyl) carbonate.
What is the SMILES notation for 1-fluoroethyl (2,4,5-tritert-butylphenyl) carbonate?
The canonical SMILES for 1-fluoroethyl (2,4,5-tritert-butylphenyl) carbonate is CC(F)OC(=O)Oc1cc(C(C)(C)C)c(C(C)(C)C)cc1C(C)(C)C.
What is the InChIKey of 1-fluoroethyl (2,4,5-tritert-butylphenyl) carbonate?
The InChIKey is WBOFINDHEOVVLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H33FO3/c1-13(22)24-18(23)25-17-12-15(20(5,6)7)14(19(2,3)4)11-16(17)21(8,9)10/h11-13H,1-10H3.
What are the key properties of 1-fluoroethyl (2,4,5-tritert-butylphenyl) carbonate?
1-fluoroethyl (2,4,5-tritert-butylphenyl) carbonate has a molecular weight of 352.49 g/mol, XLogP of 6.41, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoroethyl (2,4,5-tritert-butylphenyl) carbonate is sourced from PubChem (CID 67160861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).