C36H32ClFN8O — CID 67161024
2-chloro-N-[3-[3-[2-[4-(4-ethylpiperazin-1-yl)anilino]pyrimidin-4-yl]imidazo[1,2-a]pyridin-2-yl]phenyl]-6-fluorobenzamide (PubChem CID 67161024) has the molecular formula C36H32ClFN8O and a molecular weight of 647.16 g/mol. Its IUPAC name is 2-chloro-N-[3-[3-[2-[4-(4-ethylpiperazin-1-yl)anilino]pyrimidin-4-yl]imidazo[1,2-a]pyridin-2-yl]phenyl]-6-fluorobenzamide.
| Compound Name | 2-chloro-N-[3-[3-[2-[4-(4-ethylpiperazin-1-yl)anilino]pyrimidin-4-yl]imidazo[1,2-a]pyridin-2-yl]phenyl]-6-fluorobenzamide |
|---|---|
| PubChem CID | 67161024 |
| Molecular Formula | C36H32ClFN8O |
| Molecular Weight | 647.16 g/mol |
| Exact Mass | 646.24 |
| IUPAC Name | 2-chloro-N-[3-[3-[2-[4-(4-ethylpiperazin-1-yl)anilino]pyrimidin-4-yl]imidazo[1,2-a]pyridin-2-yl]phenyl]-6-fluorobenzamide |
| SMILES | CCN1CCN(c2ccc(Nc3nccc(-c4c(-c5cccc(NC(=O)c6c(F)cccc6Cl)c5)nc5ccccn45)n3)cc2)CC1 |
| InChI | InChI=1S/C36H32ClFN8O/c1-2-44-19-21-45(22-20-44)27-14-12-25(13-15-27)41-36-39-17-16-30(42-36)34-33(43-31-11-3-4-18-46(31)34)24-7-5-8-26(23-24)40-35(47)32-28(37)9-6-10-29(32)38/h3-18,23H,2,19-22H2,1H3,(H,40,47)(H,39,41,42) |
| InChIKey | TUYSUULRBVXYEO-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 90.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.16 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|