About (3,5-difluorophenyl) 2-methylpropyl carbonate
(3,5-difluorophenyl) 2-methylpropyl carbonate (PubChem CID 67161652) has the molecular formula C11H12F2O3
and a molecular weight of 230.21 g/mol. Its IUPAC name is (3,5-difluorophenyl) 2-methylpropyl carbonate.
Molecular Properties
| Compound Name | (3,5-difluorophenyl) 2-methylpropyl carbonate |
| PubChem CID | 67161652 |
| Molecular Formula | C11H12F2O3 |
| Molecular Weight | 230.21 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | (3,5-difluorophenyl) 2-methylpropyl carbonate |
| SMILES | CC(C)COC(=O)Oc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C11H12F2O3/c1-7(2)6-15-11(14)16-10-4-8(12)3-9(13)5-10/h3-5,7H,6H2,1-2H3 |
| InChIKey | ZMJNKEALKFWQLQ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.21 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze (3,5-difluorophenyl) 2-methylpropyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,5-difluorophenyl) 2-methylpropyl carbonate?
The IUPAC name of (3,5-difluorophenyl) 2-methylpropyl carbonate (CID 67161652) is (3,5-difluorophenyl) 2-methylpropyl carbonate.
What is the SMILES notation for (3,5-difluorophenyl) 2-methylpropyl carbonate?
The canonical SMILES for (3,5-difluorophenyl) 2-methylpropyl carbonate is CC(C)COC(=O)Oc1cc(F)cc(F)c1.
What is the InChIKey of (3,5-difluorophenyl) 2-methylpropyl carbonate?
The InChIKey is ZMJNKEALKFWQLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12F2O3/c1-7(2)6-15-11(14)16-10-4-8(12)3-9(13)5-10/h3-5,7H,6H2,1-2H3.
What are the key properties of (3,5-difluorophenyl) 2-methylpropyl carbonate?
(3,5-difluorophenyl) 2-methylpropyl carbonate has a molecular weight of 230.21 g/mol, XLogP of 3.14, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-difluorophenyl) 2-methylpropyl carbonate is sourced from PubChem (CID 67161652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).