About (2-tert-butylphenyl) 2-methylbutan-2-yl carbonate
(2-tert-butylphenyl) 2-methylbutan-2-yl carbonate (PubChem CID 67161729) has the molecular formula C16H24O3
and a molecular weight of 264.36 g/mol. Its IUPAC name is (2-tert-butylphenyl) 2-methylbutan-2-yl carbonate.
Molecular Properties
| Compound Name | (2-tert-butylphenyl) 2-methylbutan-2-yl carbonate |
| PubChem CID | 67161729 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | (2-tert-butylphenyl) 2-methylbutan-2-yl carbonate |
| SMILES | CCC(C)(C)OC(=O)Oc1ccccc1C(C)(C)C |
| InChI | InChI=1S/C16H24O3/c1-7-16(5,6)19-14(17)18-13-11-9-8-10-12(13)15(2,3)4/h8-11H,7H2,1-6H3 |
| InChIKey | QBQPVCGOEMKDRK-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze (2-tert-butylphenyl) 2-methylbutan-2-yl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-tert-butylphenyl) 2-methylbutan-2-yl carbonate?
The IUPAC name of (2-tert-butylphenyl) 2-methylbutan-2-yl carbonate (CID 67161729) is (2-tert-butylphenyl) 2-methylbutan-2-yl carbonate.
What is the SMILES notation for (2-tert-butylphenyl) 2-methylbutan-2-yl carbonate?
The canonical SMILES for (2-tert-butylphenyl) 2-methylbutan-2-yl carbonate is CCC(C)(C)OC(=O)Oc1ccccc1C(C)(C)C.
What is the InChIKey of (2-tert-butylphenyl) 2-methylbutan-2-yl carbonate?
The InChIKey is QBQPVCGOEMKDRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24O3/c1-7-16(5,6)19-14(17)18-13-11-9-8-10-12(13)15(2,3)4/h8-11H,7H2,1-6H3.
What are the key properties of (2-tert-butylphenyl) 2-methylbutan-2-yl carbonate?
(2-tert-butylphenyl) 2-methylbutan-2-yl carbonate has a molecular weight of 264.36 g/mol, XLogP of 4.69, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-tert-butylphenyl) 2-methylbutan-2-yl carbonate is sourced from PubChem (CID 67161729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).