About phenyl 3-cyclohexylbenzoate
phenyl 3-cyclohexylbenzoate (PubChem CID 67161898) has the molecular formula C19H20O2
and a molecular weight of 280.37 g/mol. Its IUPAC name is phenyl 3-cyclohexylbenzoate.
Molecular Properties
| Compound Name | phenyl 3-cyclohexylbenzoate |
| PubChem CID | 67161898 |
| Molecular Formula | C19H20O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | phenyl 3-cyclohexylbenzoate |
| SMILES | O=C(Oc1ccccc1)c1cccc(C2CCCCC2)c1 |
| InChI | InChI=1S/C19H20O2/c20-19(21-18-12-5-2-6-13-18)17-11-7-10-16(14-17)15-8-3-1-4-9-15/h2,5-7,10-15H,1,3-4,8-9H2 |
| InChIKey | GPTIEABMPIBEAF-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze phenyl 3-cyclohexylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl 3-cyclohexylbenzoate?
The IUPAC name of phenyl 3-cyclohexylbenzoate (CID 67161898) is phenyl 3-cyclohexylbenzoate.
What is the SMILES notation for phenyl 3-cyclohexylbenzoate?
The canonical SMILES for phenyl 3-cyclohexylbenzoate is O=C(Oc1ccccc1)c1cccc(C2CCCCC2)c1.
What is the InChIKey of phenyl 3-cyclohexylbenzoate?
The InChIKey is GPTIEABMPIBEAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20O2/c20-19(21-18-12-5-2-6-13-18)17-11-7-10-16(14-17)15-8-3-1-4-9-15/h2,5-7,10-15H,1,3-4,8-9H2.
What are the key properties of phenyl 3-cyclohexylbenzoate?
phenyl 3-cyclohexylbenzoate has a molecular weight of 280.37 g/mol, XLogP of 4.95, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl 3-cyclohexylbenzoate is sourced from PubChem (CID 67161898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).