C22H18F3N9 — CID 67161924
6-(2-cyclopropylethynyl)-8-[[6-(1,2,4-triazol-1-yl)-3-pyridinyl]methyl]-4-N-(2,2,2-trifluoroethyl)pyrido[3,2-d]pyrimidine-2,4-diamine (PubChem CID 67161924) has the molecular formula C22H18F3N9 and a molecular weight of 465.44 g/mol. Its IUPAC name is 6-(2-cyclopropylethynyl)-8-[[6-(1,2,4-triazol-1-yl)-3-pyridinyl]methyl]-4-N-(2,2,2-trifluoroethyl)pyrido[3,2-d]pyrimidine-2,4-diamine.
| Compound Name | 6-(2-cyclopropylethynyl)-8-[[6-(1,2,4-triazol-1-yl)-3-pyridinyl]methyl]-4-N-(2,2,2-trifluoroethyl)pyrido[3,2-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 67161924 |
| Molecular Formula | C22H18F3N9 |
| Molecular Weight | 465.44 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | 6-(2-cyclopropylethynyl)-8-[[6-(1,2,4-triazol-1-yl)-3-pyridinyl]methyl]-4-N-(2,2,2-trifluoroethyl)pyrido[3,2-d]pyrimidine-2,4-diamine |
| SMILES | Nc1nc(NCC(F)(F)F)c2nc(C#CC3CC3)cc(Cc3ccc(-n4cncn4)nc3)c2n1 |
| InChI | InChI=1S/C22H18F3N9/c23-22(24,25)10-29-20-19-18(32-21(26)33-20)15(8-16(31-19)5-3-13-1-2-13)7-14-4-6-17(28-9-14)34-12-27-11-30-34/h4,6,8-9,11-13H,1-2,7,10H2,(H3,26,29,32,33) |
| InChIKey | ULOVKSWTSNGCHC-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 120.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.44 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|