About [6-[1-hydroxy-3-oxo-2-(1,3-thiazol-2-ylmethyl)isoindol-1-yl]-1H-benzimidazol-2-yl]carbamic acid
[6-[1-hydroxy-3-oxo-2-(1,3-thiazol-2-ylmethyl)isoindol-1-yl]-1H-benzimidazol-2-yl]carbamic acid (PubChem CID 67162534) has the molecular formula C20H15N5O4S
and a molecular weight of 421.44 g/mol. Its IUPAC name is [6-[1-hydroxy-3-oxo-2-(1,3-thiazol-2-ylmethyl)isoindol-1-yl]-1H-benzimidazol-2-yl]carbamic acid.
Molecular Properties
| Compound Name | [6-[1-hydroxy-3-oxo-2-(1,3-thiazol-2-ylmethyl)isoindol-1-yl]-1H-benzimidazol-2-yl]carbamic acid |
| PubChem CID | 67162534 |
| Molecular Formula | C20H15N5O4S |
| Molecular Weight | 421.44 g/mol |
| Exact Mass | 421.08 |
| IUPAC Name | [6-[1-hydroxy-3-oxo-2-(1,3-thiazol-2-ylmethyl)isoindol-1-yl]-1H-benzimidazol-2-yl]carbamic acid |
| SMILES | O=C(O)Nc1nc2ccc(C3(O)c4ccccc4C(=O)N3Cc3nccs3)cc2[nH]1 |
| InChI | InChI=1S/C20H15N5O4S/c26-17-12-3-1-2-4-13(12)20(29,25(17)10-16-21-7-8-30-16)11-5-6-14-15(9-11)23-18(22-14)24-19(27)28/h1-9,29H,10H2,(H,27,28)(H2,22,23,24) |
| InChIKey | DZNHUPJZXWEUMB-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 131.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.44 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [6-[1-hydroxy-3-oxo-2-(1,3-thiazol-2-ylmethyl)isoindol-1-yl]-1H-benzimidazol-2-yl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-[1-hydroxy-3-oxo-2-(1,3-thiazol-2-ylmethyl)isoindol-1-yl]-1H-benzimidazol-2-yl]carbamic acid?
The IUPAC name of [6-[1-hydroxy-3-oxo-2-(1,3-thiazol-2-ylmethyl)isoindol-1-yl]-1H-benzimidazol-2-yl]carbamic acid (CID 67162534) is [6-[1-hydroxy-3-oxo-2-(1,3-thiazol-2-ylmethyl)isoindol-1-yl]-1H-benzimidazol-2-yl]carbamic acid.
What is the SMILES notation for [6-[1-hydroxy-3-oxo-2-(1,3-thiazol-2-ylmethyl)isoindol-1-yl]-1H-benzimidazol-2-yl]carbamic acid?
The canonical SMILES for [6-[1-hydroxy-3-oxo-2-(1,3-thiazol-2-ylmethyl)isoindol-1-yl]-1H-benzimidazol-2-yl]carbamic acid is O=C(O)Nc1nc2ccc(C3(O)c4ccccc4C(=O)N3Cc3nccs3)cc2[nH]1.
What is the InChIKey of [6-[1-hydroxy-3-oxo-2-(1,3-thiazol-2-ylmethyl)isoindol-1-yl]-1H-benzimidazol-2-yl]carbamic acid?
The InChIKey is DZNHUPJZXWEUMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15N5O4S/c26-17-12-3-1-2-4-13(12)20(29,25(17)10-16-21-7-8-30-16)11-5-6-14-15(9-11)23-18(22-14)24-19(27)28/h1-9,29H,10H2,(H,27,28)(H2,22,23,24).
What are the key properties of [6-[1-hydroxy-3-oxo-2-(1,3-thiazol-2-ylmethyl)isoindol-1-yl]-1H-benzimidazol-2-yl]carbamic acid?
[6-[1-hydroxy-3-oxo-2-(1,3-thiazol-2-ylmethyl)isoindol-1-yl]-1H-benzimidazol-2-yl]carbamic acid has a molecular weight of 421.44 g/mol, XLogP of 2.96, 4 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [6-[1-hydroxy-3-oxo-2-(1,3-thiazol-2-ylmethyl)isoindol-1-yl]-1H-benzimidazol-2-yl]carbamic acid is sourced from PubChem (CID 67162534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).