C25H24F3N3O2 — CID 67162859
5-[6-(3-phenylphenyl)-3-pyridinyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;2,2,2-trifluoroacetic acid (PubChem CID 67162859) has the molecular formula C25H24F3N3O2 and a molecular weight of 455.48 g/mol. Its IUPAC name is 5-[6-(3-phenylphenyl)-3-pyridinyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;2,2,2-trifluoroacetic acid.
| Compound Name | 5-[6-(3-phenylphenyl)-3-pyridinyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67162859 |
| Molecular Formula | C25H24F3N3O2 |
| Molecular Weight | 455.48 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | 5-[6-(3-phenylphenyl)-3-pyridinyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.c1ccc(-c2cccc(-c3ccc(N4CC5CNCC5C4)cn3)c2)cc1 |
| InChI | InChI=1S/C23H23N3.C2HF3O2/c1-2-5-17(6-3-1)18-7-4-8-19(11-18)23-10-9-22(14-25-23)26-15-20-12-24-13-21(20)16-26;3-2(4,5)1(6)7/h1-11,14,20-21,24H,12-13,15-16H2;(H,6,7) |
| InChIKey | JQVRZCLEUVKTGY-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.48 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |