C15H17N3O2 — CID 67162995
(2S)-N-[1-(1H-indol-2-yl)ethyl]-5-oxopyrrolidine-2-carboxamide (PubChem CID 67162995) has the molecular formula C15H17N3O2 and a molecular weight of 271.32 g/mol. Its IUPAC name is (2S)-N-[1-(1H-indol-2-yl)ethyl]-5-oxopyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[1-(1H-indol-2-yl)ethyl]-5-oxopyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 67162995 |
| Molecular Formula | C15H17N3O2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | (2S)-N-[1-(1H-indol-2-yl)ethyl]-5-oxopyrrolidine-2-carboxamide |
| SMILES | CC(NC(=O)[C@@H]1CCC(=O)N1)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C15H17N3O2/c1-9(16-15(20)12-6-7-14(19)18-12)13-8-10-4-2-3-5-11(10)17-13/h2-5,8-9,12,17H,6-7H2,1H3,(H,16,20)(H,18,19)/t9?,12-/m0/s1 |
| InChIKey | BJNLTMJUDJQSAC-ACGXKRRESA-N |
| XLogP | 1.62 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |