C30H43N7O — CID 67163063
(E)-3-[4-[[[4-(dipropylamino)cyclohexyl]amino]methyl]phenyl]-N,N-bis(1H-imidazol-2-ylmethyl)prop-2-enamide (PubChem CID 67163063) has the molecular formula C30H43N7O and a molecular weight of 517.72 g/mol. Its IUPAC name is (E)-3-[4-[[[4-(dipropylamino)cyclohexyl]amino]methyl]phenyl]-N,N-bis(1H-imidazol-2-ylmethyl)prop-2-enamide.
| Compound Name | (E)-3-[4-[[[4-(dipropylamino)cyclohexyl]amino]methyl]phenyl]-N,N-bis(1H-imidazol-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 67163063 |
| Molecular Formula | C30H43N7O |
| Molecular Weight | 517.72 g/mol |
| Exact Mass | 517.35 |
| IUPAC Name | (E)-3-[4-[[[4-(dipropylamino)cyclohexyl]amino]methyl]phenyl]-N,N-bis(1H-imidazol-2-ylmethyl)prop-2-enamide |
| SMILES | CCCN(CCC)C1CCC(NCc2ccc(/C=C/C(=O)N(Cc3ncc[nH]3)Cc3ncc[nH]3)cc2)CC1 |
| InChI | InChI=1S/C30H43N7O/c1-3-19-36(20-4-2)27-12-10-26(11-13-27)35-21-25-7-5-24(6-8-25)9-14-30(38)37(22-28-31-15-16-32-28)23-29-33-17-18-34-29/h5-9,14-18,26-27,35H,3-4,10-13,19-23H2,1-2H3,(H,31,32)(H,33,34)/b14-9+ |
| InChIKey | PZQZVOOSDHBVSR-NTEUORMPSA-N |
| XLogP | 4.90 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.72 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|