C23H27ClN6O2 — CID 67163121
(E)-3-[4-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-2H-pyrazolo[3,4-d]pyrimidin-3-yl]-4,4-dimethylpent-2-enoic acid (PubChem CID 67163121) has the molecular formula C23H27ClN6O2 and a molecular weight of 454.96 g/mol. Its IUPAC name is (E)-3-[4-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-2H-pyrazolo[3,4-d]pyrimidin-3-yl]-4,4-dimethylpent-2-enoic acid.
| Compound Name | (E)-3-[4-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-2H-pyrazolo[3,4-d]pyrimidin-3-yl]-4,4-dimethylpent-2-enoic acid |
|---|---|
| PubChem CID | 67163121 |
| Molecular Formula | C23H27ClN6O2 |
| Molecular Weight | 454.96 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | (E)-3-[4-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-2H-pyrazolo[3,4-d]pyrimidin-3-yl]-4,4-dimethylpent-2-enoic acid |
| SMILES | Cc1ccc(Cl)cc1N1CCN(c2ncnc3n[nH]c(/C(=C/C(=O)O)C(C)(C)C)c23)CC1 |
| InChI | InChI=1S/C23H27ClN6O2/c1-14-5-6-15(24)11-17(14)29-7-9-30(10-8-29)22-19-20(27-28-21(19)25-13-26-22)16(12-18(31)32)23(2,3)4/h5-6,11-13H,7-10H2,1-4H3,(H,31,32)(H,25,26,27,28)/b16-12- |
| InChIKey | VCAGKHVPTHPWLV-VBKFSLOCSA-N |
| XLogP | 4.16 |
| TPSA | 98.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.96 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|