C12H6O8S2-2 — CID 67163183
3,7-dicarboxynaphthalene-1,5-disulfinate (PubChem CID 67163183) has the molecular formula C12H6O8S2-2 and a molecular weight of 342.31 g/mol. Its IUPAC name is 3,7-dicarboxynaphthalene-1,5-disulfinate.
| Compound Name | 3,7-dicarboxynaphthalene-1,5-disulfinate |
|---|---|
| PubChem CID | 67163183 |
| Molecular Formula | C12H6O8S2-2 |
| Molecular Weight | 342.31 g/mol |
| Exact Mass | 341.95 |
| IUPAC Name | 3,7-dicarboxynaphthalene-1,5-disulfinate |
| SMILES | O=C(O)c1cc(S(=O)[O-])c2cc(C(=O)O)cc(S(=O)[O-])c2c1 |
| InChI | InChI=1S/C12H8O8S2/c13-11(14)5-1-7-8(10(3-5)22(19)20)2-6(12(15)16)4-9(7)21(17)18/h1-4H,(H,13,14)(H,15,16)(H,17,18)(H,19,20)/p-2 |
| InChIKey | HAWDPXZPVKZWQM-UHFFFAOYSA-L |
| XLogP | 0.71 |
| TPSA | 154.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.31 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|