About 4-hydroxyimidazo[1,2-a]pyridin-4-ium-7-carboxamide
4-hydroxyimidazo[1,2-a]pyridin-4-ium-7-carboxamide (PubChem CID 67163345) has the molecular formula C8H8N3O2+
and a molecular weight of 178.17 g/mol. Its IUPAC name is 4-hydroxyimidazo[1,2-a]pyridin-4-ium-7-carboxamide.
Molecular Properties
| Compound Name | 4-hydroxyimidazo[1,2-a]pyridin-4-ium-7-carboxamide |
| PubChem CID | 67163345 |
| Molecular Formula | C8H8N3O2+ |
| Molecular Weight | 178.17 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | 4-hydroxyimidazo[1,2-a]pyridin-4-ium-7-carboxamide |
| SMILES | NC(=O)C1=CC2=NC=C[N+]2(O)C=C1 |
| InChI | InChI=1S/C8H7N3O2/c9-8(12)6-1-3-11(13)4-2-10-7(11)5-6/h1-5,13H,(H-,9,12)/p+1 |
| InChIKey | YSWXQLCPQXSJSB-UHFFFAOYSA-O |
| XLogP | 0.01 |
| TPSA | 75.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.17 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxyimidazo[1,2-a]pyridin-4-ium-7-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxyimidazo[1,2-a]pyridin-4-ium-7-carboxamide?
The IUPAC name of 4-hydroxyimidazo[1,2-a]pyridin-4-ium-7-carboxamide (CID 67163345) is 4-hydroxyimidazo[1,2-a]pyridin-4-ium-7-carboxamide.
What is the SMILES notation for 4-hydroxyimidazo[1,2-a]pyridin-4-ium-7-carboxamide?
The canonical SMILES for 4-hydroxyimidazo[1,2-a]pyridin-4-ium-7-carboxamide is NC(=O)C1=CC2=NC=C[N+]2(O)C=C1.
What is the InChIKey of 4-hydroxyimidazo[1,2-a]pyridin-4-ium-7-carboxamide?
The InChIKey is YSWXQLCPQXSJSB-UHFFFAOYSA-O. The full InChI is InChI=1S/C8H7N3O2/c9-8(12)6-1-3-11(13)4-2-10-7(11)5-6/h1-5,13H,(H-,9,12)/p+1.
What are the key properties of 4-hydroxyimidazo[1,2-a]pyridin-4-ium-7-carboxamide?
4-hydroxyimidazo[1,2-a]pyridin-4-ium-7-carboxamide has a molecular weight of 178.17 g/mol, XLogP of 0.01, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxyimidazo[1,2-a]pyridin-4-ium-7-carboxamide is sourced from PubChem (CID 67163345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).