About 2-(4-ethenylphenyl)oxane
2-(4-ethenylphenyl)oxane (PubChem CID 67163438) has the molecular formula C13H16O
and a molecular weight of 188.27 g/mol. Its IUPAC name is 2-(4-ethenylphenyl)oxane.
Molecular Properties
| Compound Name | 2-(4-ethenylphenyl)oxane |
| PubChem CID | 67163438 |
| Molecular Formula | C13H16O |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | 2-(4-ethenylphenyl)oxane |
| SMILES | C=Cc1ccc(C2CCCCO2)cc1 |
| InChI | InChI=1S/C13H16O/c1-2-11-6-8-12(9-7-11)13-5-3-4-10-14-13/h2,6-9,13H,1,3-5,10H2 |
| InChIKey | BAGJKQHPNIOGCD-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(4-ethenylphenyl)oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-ethenylphenyl)oxane?
The IUPAC name of 2-(4-ethenylphenyl)oxane (CID 67163438) is 2-(4-ethenylphenyl)oxane.
What is the SMILES notation for 2-(4-ethenylphenyl)oxane?
The canonical SMILES for 2-(4-ethenylphenyl)oxane is C=Cc1ccc(C2CCCCO2)cc1.
What is the InChIKey of 2-(4-ethenylphenyl)oxane?
The InChIKey is BAGJKQHPNIOGCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O/c1-2-11-6-8-12(9-7-11)13-5-3-4-10-14-13/h2,6-9,13H,1,3-5,10H2.
What are the key properties of 2-(4-ethenylphenyl)oxane?
2-(4-ethenylphenyl)oxane has a molecular weight of 188.27 g/mol, XLogP of 3.57, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-ethenylphenyl)oxane is sourced from PubChem (CID 67163438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).