C21H25ClF3N3O2 — CID 67164245
8-[2-chloro-5-(trifluoromethyl)benzoyl]-2-propan-2-yl-4-prop-2-enyl-1,4,8-triazaspiro[4.5]decan-3-one (PubChem CID 67164245) has the molecular formula C21H25ClF3N3O2 and a molecular weight of 443.90 g/mol. Its IUPAC name is 8-[2-chloro-5-(trifluoromethyl)benzoyl]-2-propan-2-yl-4-prop-2-enyl-1,4,8-triazaspiro[4.5]decan-3-one.
| Compound Name | 8-[2-chloro-5-(trifluoromethyl)benzoyl]-2-propan-2-yl-4-prop-2-enyl-1,4,8-triazaspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 67164245 |
| Molecular Formula | C21H25ClF3N3O2 |
| Molecular Weight | 443.90 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | 8-[2-chloro-5-(trifluoromethyl)benzoyl]-2-propan-2-yl-4-prop-2-enyl-1,4,8-triazaspiro[4.5]decan-3-one |
| SMILES | C=CCN1C(=O)C(C(C)C)NC12CCN(C(=O)c1cc(C(F)(F)F)ccc1Cl)CC2 |
| InChI | InChI=1S/C21H25ClF3N3O2/c1-4-9-28-19(30)17(13(2)3)26-20(28)7-10-27(11-8-20)18(29)15-12-14(21(23,24)25)5-6-16(15)22/h4-6,12-13,17,26H,1,7-11H2,2-3H3 |
| InChIKey | GNGDYYFKCCDNFK-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.90 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|