C21H34N2O2 — CID 67164447
methyl 2-[4-(dipropylamino)butyl]-3,4-dihydro-1H-isoquinoline-6-carboxylate (PubChem CID 67164447) has the molecular formula C21H34N2O2 and a molecular weight of 346.52 g/mol. Its IUPAC name is methyl 2-[4-(dipropylamino)butyl]-3,4-dihydro-1H-isoquinoline-6-carboxylate.
| Compound Name | methyl 2-[4-(dipropylamino)butyl]-3,4-dihydro-1H-isoquinoline-6-carboxylate |
|---|---|
| PubChem CID | 67164447 |
| Molecular Formula | C21H34N2O2 |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.26 |
| IUPAC Name | methyl 2-[4-(dipropylamino)butyl]-3,4-dihydro-1H-isoquinoline-6-carboxylate |
| SMILES | CCCN(CCC)CCCCN1CCc2cc(C(=O)OC)ccc2C1 |
| InChI | InChI=1S/C21H34N2O2/c1-4-11-22(12-5-2)13-6-7-14-23-15-10-18-16-19(21(24)25-3)8-9-20(18)17-23/h8-9,16H,4-7,10-15,17H2,1-3H3 |
| InChIKey | JBNFEMQRXKBFSY-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|