About 2,7-bis[3-(dimethylamino)pyrrolidin-1-yl]fluoren-9-one;dihydrochloride
2,7-bis[3-(dimethylamino)pyrrolidin-1-yl]fluoren-9-one;dihydrochloride (PubChem CID 67164499) has the molecular formula C25H34Cl2N4O
and a molecular weight of 477.48 g/mol. Its IUPAC name is 2,7-bis[3-(dimethylamino)pyrrolidin-1-yl]fluoren-9-one;dihydrochloride.
Molecular Properties
| Compound Name | 2,7-bis[3-(dimethylamino)pyrrolidin-1-yl]fluoren-9-one;dihydrochloride |
| PubChem CID | 67164499 |
| Molecular Formula | C25H34Cl2N4O |
| Molecular Weight | 477.48 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | 2,7-bis[3-(dimethylamino)pyrrolidin-1-yl]fluoren-9-one;dihydrochloride |
| SMILES | CN(C)C1CCN(c2ccc3c(c2)C(=O)c2cc(N4CCC(N(C)C)C4)ccc2-3)C1.Cl.Cl |
| InChI | InChI=1S/C25H32N4O.2ClH/c1-26(2)19-9-11-28(15-19)17-5-7-21-22-8-6-18(14-24(22)25(30)23(21)13-17)29-12-10-20(16-29)27(3)4;;/h5-8,13-14,19-20H,9-12,15-16H2,1-4H3;2*1H |
| InChIKey | CJQBLHXTXGQVIS-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 30.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 477.48 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2,7-bis[3-(dimethylamino)pyrrolidin-1-yl]fluoren-9-one;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-bis[3-(dimethylamino)pyrrolidin-1-yl]fluoren-9-one;dihydrochloride?
The IUPAC name of 2,7-bis[3-(dimethylamino)pyrrolidin-1-yl]fluoren-9-one;dihydrochloride (CID 67164499) is 2,7-bis[3-(dimethylamino)pyrrolidin-1-yl]fluoren-9-one;dihydrochloride.
What is the SMILES notation for 2,7-bis[3-(dimethylamino)pyrrolidin-1-yl]fluoren-9-one;dihydrochloride?
The canonical SMILES for 2,7-bis[3-(dimethylamino)pyrrolidin-1-yl]fluoren-9-one;dihydrochloride is CN(C)C1CCN(c2ccc3c(c2)C(=O)c2cc(N4CCC(N(C)C)C4)ccc2-3)C1.Cl.Cl.
What is the InChIKey of 2,7-bis[3-(dimethylamino)pyrrolidin-1-yl]fluoren-9-one;dihydrochloride?
The InChIKey is CJQBLHXTXGQVIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H32N4O.2ClH/c1-26(2)19-9-11-28(15-19)17-5-7-21-22-8-6-18(14-24(22)25(30)23(21)13-17)29-12-10-20(16-29)27(3)4;;/h5-8,13-14,19-20H,9-12,15-16H2,1-4H3;2*1H.
What are the key properties of 2,7-bis[3-(dimethylamino)pyrrolidin-1-yl]fluoren-9-one;dihydrochloride?
2,7-bis[3-(dimethylamino)pyrrolidin-1-yl]fluoren-9-one;dihydrochloride has a molecular weight of 477.48 g/mol, XLogP of 4.02, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-bis[3-(dimethylamino)pyrrolidin-1-yl]fluoren-9-one;dihydrochloride is sourced from PubChem (CID 67164499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).