About 2-prop-2-enylcyclohexa-2,4-dien-1-one
2-prop-2-enylcyclohexa-2,4-dien-1-one (PubChem CID 67164632) has the molecular formula C9H10O
and a molecular weight of 134.18 g/mol. Its IUPAC name is 2-prop-2-enylcyclohexa-2,4-dien-1-one.
Molecular Properties
| Compound Name | 2-prop-2-enylcyclohexa-2,4-dien-1-one |
| PubChem CID | 67164632 |
| Molecular Formula | C9H10O |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.07 |
| IUPAC Name | 2-prop-2-enylcyclohexa-2,4-dien-1-one |
| SMILES | C=CCC1=CC=CCC1=O |
| InChI | InChI=1S/C9H10O/c1-2-5-8-6-3-4-7-9(8)10/h2-4,6H,1,5,7H2 |
| InChIKey | BQTQPRBKBAIGHL-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-prop-2-enylcyclohexa-2,4-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-prop-2-enylcyclohexa-2,4-dien-1-one?
The IUPAC name of 2-prop-2-enylcyclohexa-2,4-dien-1-one (CID 67164632) is 2-prop-2-enylcyclohexa-2,4-dien-1-one.
What is the SMILES notation for 2-prop-2-enylcyclohexa-2,4-dien-1-one?
The canonical SMILES for 2-prop-2-enylcyclohexa-2,4-dien-1-one is C=CCC1=CC=CCC1=O.
What is the InChIKey of 2-prop-2-enylcyclohexa-2,4-dien-1-one?
The InChIKey is BQTQPRBKBAIGHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O/c1-2-5-8-6-3-4-7-9(8)10/h2-4,6H,1,5,7H2.
What are the key properties of 2-prop-2-enylcyclohexa-2,4-dien-1-one?
2-prop-2-enylcyclohexa-2,4-dien-1-one has a molecular weight of 134.18 g/mol, XLogP of 2.02, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-prop-2-enylcyclohexa-2,4-dien-1-one is sourced from PubChem (CID 67164632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).