C20H21Cl2N3O — CID 67165264
2-amino-7-(2-methyl-1,4,6,6a-tetrahydropyrrolo[3,4-c]pyrrol-5-yl)fluoren-9-one;dihydrochloride (PubChem CID 67165264) has the molecular formula C20H21Cl2N3O and a molecular weight of 390.31 g/mol. Its IUPAC name is 2-amino-7-(2-methyl-1,4,6,6a-tetrahydropyrrolo[3,4-c]pyrrol-5-yl)fluoren-9-one;dihydrochloride.
| Compound Name | 2-amino-7-(2-methyl-1,4,6,6a-tetrahydropyrrolo[3,4-c]pyrrol-5-yl)fluoren-9-one;dihydrochloride |
|---|---|
| PubChem CID | 67165264 |
| Molecular Formula | C20H21Cl2N3O |
| Molecular Weight | 390.31 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | 2-amino-7-(2-methyl-1,4,6,6a-tetrahydropyrrolo[3,4-c]pyrrol-5-yl)fluoren-9-one;dihydrochloride |
| SMILES | CN1C=C2CN(c3ccc4c(c3)C(=O)c3cc(N)ccc3-4)CC2C1.Cl.Cl |
| InChI | InChI=1S/C20H19N3O.2ClH/c1-22-8-12-10-23(11-13(12)9-22)15-3-5-17-16-4-2-14(21)6-18(16)20(24)19(17)7-15;;/h2-8,13H,9-11,21H2,1H3;2*1H |
| InChIKey | WJVRMIBVNXFBON-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.31 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|