About acetic acid;7-(2-amino-1-hydroxyethyl)-4-hydroxy-3H-1,3-benzothiazol-2-one
acetic acid;7-(2-amino-1-hydroxyethyl)-4-hydroxy-3H-1,3-benzothiazol-2-one (PubChem CID 67166260) has the molecular formula C11H14N2O5S
and a molecular weight of 286.31 g/mol. Its IUPAC name is acetic acid;7-(2-amino-1-hydroxyethyl)-4-hydroxy-3H-1,3-benzothiazol-2-one.
Molecular Properties
| Compound Name | acetic acid;7-(2-amino-1-hydroxyethyl)-4-hydroxy-3H-1,3-benzothiazol-2-one |
| PubChem CID | 67166260 |
| Molecular Formula | C11H14N2O5S |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | acetic acid;7-(2-amino-1-hydroxyethyl)-4-hydroxy-3H-1,3-benzothiazol-2-one |
| SMILES | CC(=O)O.NCC(O)c1ccc(O)c2[nH]c(=O)sc12 |
| InChI | InChI=1S/C9H10N2O3S.C2H4O2/c10-3-6(13)4-1-2-5(12)7-8(4)15-9(14)11-7;1-2(3)4/h1-2,6,12-13H,3,10H2,(H,11,14);1H3,(H,3,4) |
| InChIKey | BVHFKFPUQGRCBE-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 136.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze acetic acid;7-(2-amino-1-hydroxyethyl)-4-hydroxy-3H-1,3-benzothiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;7-(2-amino-1-hydroxyethyl)-4-hydroxy-3H-1,3-benzothiazol-2-one?
The IUPAC name of acetic acid;7-(2-amino-1-hydroxyethyl)-4-hydroxy-3H-1,3-benzothiazol-2-one (CID 67166260) is acetic acid;7-(2-amino-1-hydroxyethyl)-4-hydroxy-3H-1,3-benzothiazol-2-one.
What is the SMILES notation for acetic acid;7-(2-amino-1-hydroxyethyl)-4-hydroxy-3H-1,3-benzothiazol-2-one?
The canonical SMILES for acetic acid;7-(2-amino-1-hydroxyethyl)-4-hydroxy-3H-1,3-benzothiazol-2-one is CC(=O)O.NCC(O)c1ccc(O)c2[nH]c(=O)sc12.
What is the InChIKey of acetic acid;7-(2-amino-1-hydroxyethyl)-4-hydroxy-3H-1,3-benzothiazol-2-one?
The InChIKey is BVHFKFPUQGRCBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O3S.C2H4O2/c10-3-6(13)4-1-2-5(12)7-8(4)15-9(14)11-7;1-2(3)4/h1-2,6,12-13H,3,10H2,(H,11,14);1H3,(H,3,4).
What are the key properties of acetic acid;7-(2-amino-1-hydroxyethyl)-4-hydroxy-3H-1,3-benzothiazol-2-one?
acetic acid;7-(2-amino-1-hydroxyethyl)-4-hydroxy-3H-1,3-benzothiazol-2-one has a molecular weight of 286.31 g/mol, XLogP of 0.38, 2 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;7-(2-amino-1-hydroxyethyl)-4-hydroxy-3H-1,3-benzothiazol-2-one is sourced from PubChem (CID 67166260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).