C19H33N3O2S — CID 67166399
8-(3,3-dimethylbutanoyl)-2-(2-methylsulfanylethyl)-4-prop-2-enyl-1,4,8-triazaspiro[4.5]decan-3-one (PubChem CID 67166399) has the molecular formula C19H33N3O2S and a molecular weight of 367.56 g/mol. Its IUPAC name is 8-(3,3-dimethylbutanoyl)-2-(2-methylsulfanylethyl)-4-prop-2-enyl-1,4,8-triazaspiro[4.5]decan-3-one.
| Compound Name | 8-(3,3-dimethylbutanoyl)-2-(2-methylsulfanylethyl)-4-prop-2-enyl-1,4,8-triazaspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 67166399 |
| Molecular Formula | C19H33N3O2S |
| Molecular Weight | 367.56 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | 8-(3,3-dimethylbutanoyl)-2-(2-methylsulfanylethyl)-4-prop-2-enyl-1,4,8-triazaspiro[4.5]decan-3-one |
| SMILES | C=CCN1C(=O)C(CCSC)NC12CCN(C(=O)CC(C)(C)C)CC2 |
| InChI | InChI=1S/C19H33N3O2S/c1-6-10-22-17(24)15(7-13-25-5)20-19(22)8-11-21(12-9-19)16(23)14-18(2,3)4/h6,15,20H,1,7-14H2,2-5H3 |
| InChIKey | SPJORDFTWIDBPC-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.56 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|